C7H10AsNO2 — CID 59067329
4-arsoroso-5-methyl-3-propyl-1,2-oxazole (PubChem CID 59067329) has the molecular formula C7H10AsNO2 and a molecular weight of 215.08 g/mol. Its IUPAC name is 4-arsoroso-5-methyl-3-propyl-1,2-oxazole.
| Compound Name | 4-arsoroso-5-methyl-3-propyl-1,2-oxazole |
|---|---|
| PubChem CID | 59067329 |
| Molecular Formula | C7H10AsNO2 |
| Molecular Weight | 215.08 g/mol |
| Exact Mass | 214.99 |
| IUPAC Name | 4-arsoroso-5-methyl-3-propyl-1,2-oxazole |
| SMILES | CCCc1noc(C)c1[As]=O |
| InChI | InChI=1S/C7H10AsNO2/c1-3-4-6-7(8-10)5(2)11-9-6/h3-4H2,1-2H3 |
| InChIKey | SBFRPTUDYYDQDG-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.08 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|