C37H49F3O6SSi2 — CID 159302002
[4-[ethoxy-bis(prop-2-enyl)silyl]phenyl] trifluoromethanesulfonate;ethoxy-[4-(4-methoxyphenyl)phenyl]-bis(prop-2-enyl)silane;methane (PubChem CID 159302002) has the molecular formula C37H49F3O6SSi2 and a molecular weight of 735.03 g/mol. Its IUPAC name is [4-[ethoxy-bis(prop-2-enyl)silyl]phenyl] trifluoromethanesulfonate;ethoxy-[4-(4-methoxyphenyl)phenyl]-bis(prop-2-enyl)silane;methane.
| Compound Name | [4-[ethoxy-bis(prop-2-enyl)silyl]phenyl] trifluoromethanesulfonate;ethoxy-[4-(4-methoxyphenyl)phenyl]-bis(prop-2-enyl)silane;methane |
|---|---|
| PubChem CID | 159302002 |
| Molecular Formula | C37H49F3O6SSi2 |
| Molecular Weight | 735.03 g/mol |
| Exact Mass | 734.27 |
| IUPAC Name | [4-[ethoxy-bis(prop-2-enyl)silyl]phenyl] trifluoromethanesulfonate;ethoxy-[4-(4-methoxyphenyl)phenyl]-bis(prop-2-enyl)silane;methane |
| SMILES | C.C=CC[Si](CC=C)(OCC)c1ccc(-c2ccc(OC)cc2)cc1.C=CC[Si](CC=C)(OCC)c1ccc(OS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H26O2Si.C15H19F3O4SSi.CH4/c1-5-16-24(17-6-2,23-7-3)21-14-10-19(11-15-21)18-8-12-20(22-4)13-9-18;1-4-11-24(12-5-2,21-6-3)14-9-7-13(8-10-14)22-23(19,20)15(16,17)18;/h5-6,8-15H,1-2,7,16-17H2,3-4H3;4-5,7-10H,1-2,6,11-12H2,3H3;1H4 |
| InChIKey | LBLIRFNLFOFTRT-UHFFFAOYSA-N |
| XLogP | 9.04 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.03 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|