C13H12O3S — CID 159303097
2,3-dimethyl-4-oxo-5H-1-benzothiepine-7-carboxylic acid (PubChem CID 159303097) has the molecular formula C13H12O3S and a molecular weight of 248.30 g/mol. Its IUPAC name is 2,3-dimethyl-4-oxo-5H-1-benzothiepine-7-carboxylic acid.
| Compound Name | 2,3-dimethyl-4-oxo-5H-1-benzothiepine-7-carboxylic acid |
|---|---|
| PubChem CID | 159303097 |
| Molecular Formula | C13H12O3S |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | 2,3-dimethyl-4-oxo-5H-1-benzothiepine-7-carboxylic acid |
| SMILES | CC1=C(C)C(=O)Cc2cc(C(=O)O)ccc2S1 |
| InChI | InChI=1S/C13H12O3S/c1-7-8(2)17-12-4-3-9(13(15)16)5-10(12)6-11(7)14/h3-5H,6H2,1-2H3,(H,15,16) |
| InChIKey | LBOSBAXNIUBZJI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |