C17H34N2 — CID 15930828
N,N'-dicyclohexyl-N,N'-diethylmethanediamine (PubChem CID 15930828) has the molecular formula C17H34N2 and a molecular weight of 266.47 g/mol. Its IUPAC name is N,N'-dicyclohexyl-N,N'-diethylmethanediamine.
| Compound Name | N,N'-dicyclohexyl-N,N'-diethylmethanediamine |
|---|---|
| PubChem CID | 15930828 |
| Molecular Formula | C17H34N2 |
| Molecular Weight | 266.47 g/mol |
| Exact Mass | 266.27 |
| IUPAC Name | N,N'-dicyclohexyl-N,N'-diethylmethanediamine |
| SMILES | CCN(CN(CC)C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C17H34N2/c1-3-18(16-11-7-5-8-12-16)15-19(4-2)17-13-9-6-10-14-17/h16-17H,3-15H2,1-2H3 |
| InChIKey | KRKPNKLRFROKSQ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.47 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|