C21H40N2Se — CID 134917415
1,3-dibutyl-1,3-dicyclohexylselenourea (PubChem CID 134917415) has the molecular formula C21H40N2Se and a molecular weight of 399.53 g/mol. Its IUPAC name is 1,3-dibutyl-1,3-dicyclohexylselenourea.
| Compound Name | 1,3-dibutyl-1,3-dicyclohexylselenourea |
|---|---|
| PubChem CID | 134917415 |
| Molecular Formula | C21H40N2Se |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | 1,3-dibutyl-1,3-dicyclohexylselenourea |
| SMILES | CCCCN(C(=[Se])N(CCCC)C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C21H40N2Se/c1-3-5-17-22(19-13-9-7-10-14-19)21(24)23(18-6-4-2)20-15-11-8-12-16-20/h19-20H,3-18H2,1-2H3 |
| InChIKey | PHEJOLXELRRZCT-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|