C12H24N2Se — CID 24776961
1-cyclohexyl-3,3-dimethyl-1-propan-2-ylselenourea (PubChem CID 24776961) has the molecular formula C12H24N2Se and a molecular weight of 275.30 g/mol. Its IUPAC name is 1-cyclohexyl-3,3-dimethyl-1-propan-2-ylselenourea.
| Compound Name | 1-cyclohexyl-3,3-dimethyl-1-propan-2-ylselenourea |
|---|---|
| PubChem CID | 24776961 |
| Molecular Formula | C12H24N2Se |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 1-cyclohexyl-3,3-dimethyl-1-propan-2-ylselenourea |
| SMILES | CC(C)N(C(=[Se])N(C)C)C1CCCCC1 |
| InChI | InChI=1S/C12H24N2Se/c1-10(2)14(12(15)13(3)4)11-8-6-5-7-9-11/h10-11H,5-9H2,1-4H3 |
| InChIKey | WEFWDSQOLMAXHJ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|