C19H38N2 — CID 59360796
N,N'-dicyclohexyl-N,N'-di(propan-2-yl)methanediamine (PubChem CID 59360796) has the molecular formula C19H38N2 and a molecular weight of 294.53 g/mol. Its IUPAC name is N,N'-dicyclohexyl-N,N'-di(propan-2-yl)methanediamine.
| Compound Name | N,N'-dicyclohexyl-N,N'-di(propan-2-yl)methanediamine |
|---|---|
| PubChem CID | 59360796 |
| Molecular Formula | C19H38N2 |
| Molecular Weight | 294.53 g/mol |
| Exact Mass | 294.30 |
| IUPAC Name | N,N'-dicyclohexyl-N,N'-di(propan-2-yl)methanediamine |
| SMILES | CC(C)N(CN(C(C)C)C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C19H38N2/c1-16(2)20(18-11-7-5-8-12-18)15-21(17(3)4)19-13-9-6-10-14-19/h16-19H,5-15H2,1-4H3 |
| InChIKey | OOVANARFQRXXAM-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.53 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|