C22H35BO4 — CID 159311137
3,3-dimethylbutyl 2-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoate (PubChem CID 159311137) has the molecular formula C22H35BO4 and a molecular weight of 374.33 g/mol. Its IUPAC name is 3,3-dimethylbutyl 2-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoate.
| Compound Name | 3,3-dimethylbutyl 2-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoate |
|---|---|
| PubChem CID | 159311137 |
| Molecular Formula | C22H35BO4 |
| Molecular Weight | 374.33 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | 3,3-dimethylbutyl 2-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoate |
| SMILES | CC(C)(C)CCOC(=O)C(C)(C)c1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C22H35BO4/c1-19(2,3)14-15-25-18(24)20(4,5)16-10-12-17(13-11-16)23-26-21(6,7)22(8,9)27-23/h10-13H,14-15H2,1-9H3 |
| InChIKey | SOMSKLYRIDMBPN-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.33 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|