C15H25N — CID 159340519
N,2-dimethyl-N-(1-phenylethenyl)propan-2-amine;ethane (PubChem CID 159340519) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is N,2-dimethyl-N-(1-phenylethenyl)propan-2-amine;ethane.
| Compound Name | N,2-dimethyl-N-(1-phenylethenyl)propan-2-amine;ethane |
|---|---|
| PubChem CID | 159340519 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | N,2-dimethyl-N-(1-phenylethenyl)propan-2-amine;ethane |
| SMILES | C=C(c1ccccc1)N(C)C(C)(C)C.CC |
| InChI | InChI=1S/C13H19N.C2H6/c1-11(14(5)13(2,3)4)12-9-7-6-8-10-12;1-2/h6-10H,1H2,2-5H3;1-2H3 |
| InChIKey | LGBUCLHXYZFUCU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |