C20H20N4O2S-2 — CID 172971151
(1Z,3Z)-N'-(benzenecarbonothioyl)-N,N'-dimethyl-N-(1-phenylethenyl)propanedihydrazonate (PubChem CID 172971151) has the molecular formula C20H20N4O2S-2 and a molecular weight of 380.47 g/mol. Its IUPAC name is (1Z,3Z)-N'-(benzenecarbonothioyl)-N,N'-dimethyl-N-(1-phenylethenyl)propanedihydrazonate.
| Compound Name | (1Z,3Z)-N'-(benzenecarbonothioyl)-N,N'-dimethyl-N-(1-phenylethenyl)propanedihydrazonate |
|---|---|
| PubChem CID | 172971151 |
| Molecular Formula | C20H20N4O2S-2 |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | (1Z,3Z)-N'-(benzenecarbonothioyl)-N,N'-dimethyl-N-(1-phenylethenyl)propanedihydrazonate |
| SMILES | C=C(c1ccccc1)N(C)/N=C(\[O-])C/C([O-])=N/N(C)C(=S)c1ccccc1 |
| InChI | InChI=1S/C20H22N4O2S/c1-15(16-10-6-4-7-11-16)23(2)21-18(25)14-19(26)22-24(3)20(27)17-12-8-5-9-13-17/h4-13H,1,14H2,2-3H3,(H,21,25)(H,22,26)/p-2 |
| InChIKey | OWDZQBRBNHMHDO-UHFFFAOYSA-L |
| XLogP | 1.63 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|