C23H46O8Si2 — CID 159341783
diethoxy-methyl-[1-(7-oxabicyclo[4.1.0]heptan-3-yl)ethoxy]silane;dimethoxy-methyl-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)silane (PubChem CID 159341783) has the molecular formula C23H46O8Si2 and a molecular weight of 506.79 g/mol. Its IUPAC name is diethoxy-methyl-[1-(7-oxabicyclo[4.1.0]heptan-3-yl)ethoxy]silane;dimethoxy-methyl-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)silane.
| Compound Name | diethoxy-methyl-[1-(7-oxabicyclo[4.1.0]heptan-3-yl)ethoxy]silane;dimethoxy-methyl-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)silane |
|---|---|
| PubChem CID | 159341783 |
| Molecular Formula | C23H46O8Si2 |
| Molecular Weight | 506.79 g/mol |
| Exact Mass | 506.27 |
| IUPAC Name | diethoxy-methyl-[1-(7-oxabicyclo[4.1.0]heptan-3-yl)ethoxy]silane;dimethoxy-methyl-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)silane |
| SMILES | CCO[Si](C)(OCC)OC(C)C1CCC2OC2C1.CO[Si](C)(OC)OCC1CCC2OC2C1 |
| InChI | InChI=1S/C13H26O4Si.C10H20O4Si/c1-5-14-18(4,15-6-2)17-10(3)11-7-8-12-13(9-11)16-12;1-11-15(3,12-2)13-7-8-4-5-9-10(6-8)14-9/h10-13H,5-9H2,1-4H3;8-10H,4-7H2,1-3H3 |
| InChIKey | LGFQELRBQGJYLZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 80.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.79 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|