C13H26N2O3 — CID 15936531
3-(dimethylamino)propyl 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 15936531) has the molecular formula C13H26N2O3 and a molecular weight of 258.36 g/mol. Its IUPAC name is 3-(dimethylamino)propyl 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | 3-(dimethylamino)propyl 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 15936531 |
| Molecular Formula | C13H26N2O3 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | 3-(dimethylamino)propyl 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CN(C)CCCOC(=O)N1C(C)(C)COC1(C)C |
| InChI | InChI=1S/C13H26N2O3/c1-12(2)10-18-13(3,4)15(12)11(16)17-9-7-8-14(5)6/h7-10H2,1-6H3 |
| InChIKey | VIQUVFDNMMGFCM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|