About methanesulfonoperoxoate;(4-methoxyphenyl)-dimethylsulfanium
methanesulfonoperoxoate;(4-methoxyphenyl)-dimethylsulfanium (PubChem CID 159375698) has the molecular formula C10H16O5S2
and a molecular weight of 280.37 g/mol. Its IUPAC name is methanesulfonoperoxoate;(4-methoxyphenyl)-dimethylsulfanium.
Molecular Properties
| Compound Name | methanesulfonoperoxoate;(4-methoxyphenyl)-dimethylsulfanium |
| PubChem CID | 159375698 |
| Molecular Formula | C10H16O5S2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | methanesulfonoperoxoate;(4-methoxyphenyl)-dimethylsulfanium |
| SMILES | COc1ccc([S+](C)C)cc1.CS(=O)(=O)O[O-] |
| InChI | InChI=1S/C9H13OS.CH4O4S/c1-10-8-4-6-9(7-5-8)11(2)3;1-6(3,4)5-2/h4-7H,1-3H3;2H,1H3/q+1;/p-1 |
| InChIKey | LKHDBONIQLIFHM-UHFFFAOYSA-M |
| XLogP | 0.17 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze methanesulfonoperoxoate;(4-methoxyphenyl)-dimethylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanesulfonoperoxoate;(4-methoxyphenyl)-dimethylsulfanium?
The IUPAC name of methanesulfonoperoxoate;(4-methoxyphenyl)-dimethylsulfanium (CID 159375698) is methanesulfonoperoxoate;(4-methoxyphenyl)-dimethylsulfanium.
What is the SMILES notation for methanesulfonoperoxoate;(4-methoxyphenyl)-dimethylsulfanium?
The canonical SMILES for methanesulfonoperoxoate;(4-methoxyphenyl)-dimethylsulfanium is COc1ccc([S+](C)C)cc1.CS(=O)(=O)O[O-].
What is the InChIKey of methanesulfonoperoxoate;(4-methoxyphenyl)-dimethylsulfanium?
The InChIKey is LKHDBONIQLIFHM-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H13OS.CH4O4S/c1-10-8-4-6-9(7-5-8)11(2)3;1-6(3,4)5-2/h4-7H,1-3H3;2H,1H3/q+1;/p-1.
What are the key properties of methanesulfonoperoxoate;(4-methoxyphenyl)-dimethylsulfanium?
methanesulfonoperoxoate;(4-methoxyphenyl)-dimethylsulfanium has a molecular weight of 280.37 g/mol, XLogP of 0.17, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methanesulfonoperoxoate;(4-methoxyphenyl)-dimethylsulfanium is sourced from PubChem (CID 159375698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).