C21H29NO2S — CID 159388518
S-(3-oxo-5-phenylpentyl) 3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbothioate (PubChem CID 159388518) has the molecular formula C21H29NO2S and a molecular weight of 359.54 g/mol. Its IUPAC name is S-(3-oxo-5-phenylpentyl) 3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbothioate.
| Compound Name | S-(3-oxo-5-phenylpentyl) 3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbothioate |
|---|---|
| PubChem CID | 159388518 |
| Molecular Formula | C21H29NO2S |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | S-(3-oxo-5-phenylpentyl) 3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbothioate |
| SMILES | O=C(CCSC(=O)N1CCCC2CCCCC21)CCc1ccccc1 |
| InChI | InChI=1S/C21H29NO2S/c23-19(13-12-17-7-2-1-3-8-17)14-16-25-21(24)22-15-6-10-18-9-4-5-11-20(18)22/h1-3,7-8,18,20H,4-6,9-16H2 |
| InChIKey | LLURHWPUENFVKM-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|