C20H44NO10P — CID 159389303
2-[2-[5-hydroxy-6-[4-(2-hydroxy-3-methoxypropoxy)butoxy]hexoxy]ethyl-dimethylazaniumyl]ethyl hydrogen phosphate (PubChem CID 159389303) has the molecular formula C20H44NO10P and a molecular weight of 489.54 g/mol. Its IUPAC name is 2-[2-[5-hydroxy-6-[4-(2-hydroxy-3-methoxypropoxy)butoxy]hexoxy]ethyl-dimethylazaniumyl]ethyl hydrogen phosphate.
| Compound Name | 2-[2-[5-hydroxy-6-[4-(2-hydroxy-3-methoxypropoxy)butoxy]hexoxy]ethyl-dimethylazaniumyl]ethyl hydrogen phosphate |
|---|---|
| PubChem CID | 159389303 |
| Molecular Formula | C20H44NO10P |
| Molecular Weight | 489.54 g/mol |
| Exact Mass | 489.27 |
| IUPAC Name | 2-[2-[5-hydroxy-6-[4-(2-hydroxy-3-methoxypropoxy)butoxy]hexoxy]ethyl-dimethylazaniumyl]ethyl hydrogen phosphate |
| SMILES | COCC(O)COCCCCOCC(O)CCCCOCC[N+](C)(C)CCOP(=O)([O-])O |
| InChI | InChI=1S/C20H44NO10P/c1-21(2,10-15-31-32(24,25)26)9-14-28-11-5-4-8-19(22)17-29-12-6-7-13-30-18-20(23)16-27-3/h19-20,22-23H,4-18H2,1-3H3,(H-,24,25,26) |
| InChIKey | LLXGGIWFSYYFAI-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 146.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.54 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|