C11H9N3S — CID 159395444
1,8-naphthyridine;1,3-thiazole (PubChem CID 159395444) has the molecular formula C11H9N3S and a molecular weight of 215.28 g/mol. Its IUPAC name is 1,8-naphthyridine;1,3-thiazole.
| Compound Name | 1,8-naphthyridine;1,3-thiazole |
|---|---|
| PubChem CID | 159395444 |
| Molecular Formula | C11H9N3S |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.05 |
| IUPAC Name | 1,8-naphthyridine;1,3-thiazole |
| SMILES | c1cnc2ncccc2c1.c1cscn1 |
| InChI | InChI=1S/C8H6N2.C3H3NS/c1-3-7-4-2-6-10-8(7)9-5-1;1-2-5-3-4-1/h1-6H;1-3H |
| InChIKey | LMQPGYGVVZOTDW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |