About quinolin-8-ol;1,3-thiazole
quinolin-8-ol;1,3-thiazole (PubChem CID 172854490) has the molecular formula C12H10N2OS
and a molecular weight of 230.29 g/mol. Its IUPAC name is quinolin-8-ol;1,3-thiazole.
Molecular Properties
| Compound Name | quinolin-8-ol;1,3-thiazole |
| PubChem CID | 172854490 |
| Molecular Formula | C12H10N2OS |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | quinolin-8-ol;1,3-thiazole |
| SMILES | Oc1cccc2cccnc12.c1cscn1 |
| InChI | InChI=1S/C9H7NO.C3H3NS/c11-8-5-1-3-7-4-2-6-10-9(7)8;1-2-5-3-4-1/h1-6,11H;1-3H |
| InChIKey | YMXMBXGLHZOSQP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze quinolin-8-ol;1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinolin-8-ol;1,3-thiazole?
The IUPAC name of quinolin-8-ol;1,3-thiazole (CID 172854490) is quinolin-8-ol;1,3-thiazole.
What is the SMILES notation for quinolin-8-ol;1,3-thiazole?
The canonical SMILES for quinolin-8-ol;1,3-thiazole is Oc1cccc2cccnc12.c1cscn1.
What is the InChIKey of quinolin-8-ol;1,3-thiazole?
The InChIKey is YMXMBXGLHZOSQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO.C3H3NS/c11-8-5-1-3-7-4-2-6-10-9(7)8;1-2-5-3-4-1/h1-6,11H;1-3H.
What are the key properties of quinolin-8-ol;1,3-thiazole?
quinolin-8-ol;1,3-thiazole has a molecular weight of 230.29 g/mol, XLogP of 3.08, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for quinolin-8-ol;1,3-thiazole is sourced from PubChem (CID 172854490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).