About quinoline;1,3-thiazole;hydrobromide
quinoline;1,3-thiazole;hydrobromide (PubChem CID 174594255) has the molecular formula C12H11BrN2S
and a molecular weight of 295.21 g/mol. Its IUPAC name is quinoline;1,3-thiazole;hydrobromide.
Molecular Properties
| Compound Name | quinoline;1,3-thiazole;hydrobromide |
| PubChem CID | 174594255 |
| Molecular Formula | C12H11BrN2S |
| Molecular Weight | 295.21 g/mol |
| Exact Mass | 293.98 |
| IUPAC Name | quinoline;1,3-thiazole;hydrobromide |
| SMILES | Br.c1ccc2ncccc2c1.c1cscn1 |
| InChI | InChI=1S/C9H7N.C3H3NS.BrH/c1-2-6-9-8(4-1)5-3-7-10-9;1-2-5-3-4-1;/h1-7H;1-3H;1H |
| InChIKey | CTJFOXDVNNRSDX-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.21 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze quinoline;1,3-thiazole;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinoline;1,3-thiazole;hydrobromide?
The IUPAC name of quinoline;1,3-thiazole;hydrobromide (CID 174594255) is quinoline;1,3-thiazole;hydrobromide.
What is the SMILES notation for quinoline;1,3-thiazole;hydrobromide?
The canonical SMILES for quinoline;1,3-thiazole;hydrobromide is Br.c1ccc2ncccc2c1.c1cscn1.
What is the InChIKey of quinoline;1,3-thiazole;hydrobromide?
The InChIKey is CTJFOXDVNNRSDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C3H3NS.BrH/c1-2-6-9-8(4-1)5-3-7-10-9;1-2-5-3-4-1;/h1-7H;1-3H;1H.
What are the key properties of quinoline;1,3-thiazole;hydrobromide?
quinoline;1,3-thiazole;hydrobromide has a molecular weight of 295.21 g/mol, XLogP of 3.96, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for quinoline;1,3-thiazole;hydrobromide is sourced from PubChem (CID 174594255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).