About dichloroplatinum(2+);2-(dimethylamino)ethylazanide
dichloroplatinum(2+);2-(dimethylamino)ethylazanide (PubChem CID 15939718) has the molecular formula C4H11Cl2N2Pt+
and a molecular weight of 353.13 g/mol. Its IUPAC name is dichloroplatinum(2+);2-(dimethylamino)ethylazanide.
Molecular Properties
| Compound Name | dichloroplatinum(2+);2-(dimethylamino)ethylazanide |
| PubChem CID | 15939718 |
| Molecular Formula | C4H11Cl2N2Pt+ |
| Molecular Weight | 353.13 g/mol |
| Exact Mass | 351.99 |
| IUPAC Name | dichloroplatinum(2+);2-(dimethylamino)ethylazanide |
| SMILES | CN(C)CC[NH-].Cl[Pt+2]Cl |
| InChI | InChI=1S/C4H11N2.2ClH.Pt/c1-6(2)4-3-5;;;/h5H,3-4H2,1-2H3;2*1H;/q-1;;;+4/p-2 |
| InChIKey | UFONNYUFTDSVKO-UHFFFAOYSA-L |
| XLogP | 1.98 |
| TPSA | 27.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.13 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze dichloroplatinum(2+);2-(dimethylamino)ethylazanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloroplatinum(2+);2-(dimethylamino)ethylazanide?
The IUPAC name of dichloroplatinum(2+);2-(dimethylamino)ethylazanide (CID 15939718) is dichloroplatinum(2+);2-(dimethylamino)ethylazanide.
What is the SMILES notation for dichloroplatinum(2+);2-(dimethylamino)ethylazanide?
The canonical SMILES for dichloroplatinum(2+);2-(dimethylamino)ethylazanide is CN(C)CC[NH-].Cl[Pt+2]Cl.
What is the InChIKey of dichloroplatinum(2+);2-(dimethylamino)ethylazanide?
The InChIKey is UFONNYUFTDSVKO-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H11N2.2ClH.Pt/c1-6(2)4-3-5;;;/h5H,3-4H2,1-2H3;2*1H;/q-1;;;+4/p-2.
What are the key properties of dichloroplatinum(2+);2-(dimethylamino)ethylazanide?
dichloroplatinum(2+);2-(dimethylamino)ethylazanide has a molecular weight of 353.13 g/mol, XLogP of 1.98, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dichloroplatinum(2+);2-(dimethylamino)ethylazanide is sourced from PubChem (CID 15939718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).