C23H31N5O4Si — CID 159398488
1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-nitro-4-(1-pyrimidin-2-ylethylamino)quinolin-2-one (PubChem CID 159398488) has the molecular formula C23H31N5O4Si and a molecular weight of 469.62 g/mol. Its IUPAC name is 1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-nitro-4-(1-pyrimidin-2-ylethylamino)quinolin-2-one.
| Compound Name | 1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-nitro-4-(1-pyrimidin-2-ylethylamino)quinolin-2-one |
|---|---|
| PubChem CID | 159398488 |
| Molecular Formula | C23H31N5O4Si |
| Molecular Weight | 469.62 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | 1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-nitro-4-(1-pyrimidin-2-ylethylamino)quinolin-2-one |
| SMILES | CC(Nc1cc(=O)n(CCO[Si](C)(C)C(C)(C)C)c2ccc([N+](=O)[O-])cc12)c1ncccn1 |
| InChI | InChI=1S/C23H31N5O4Si/c1-16(22-24-10-7-11-25-22)26-19-15-21(29)27(12-13-32-33(5,6)23(2,3)4)20-9-8-17(28(30)31)14-18(19)20/h7-11,14-16,26H,12-13H2,1-6H3 |
| InChIKey | LNAOJSHXGMLBKO-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.62 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|