C27H47NO9 — CID 159405637
6-O-[2-[2-[3-[5-(ethoxycarbonylamino)-1,3,3-trimethylcyclohexyl]propanoyloxy]ethoxy]ethyl] 1-O-ethyl hexanedioate (PubChem CID 159405637) has the molecular formula C27H47NO9 and a molecular weight of 529.67 g/mol. Its IUPAC name is 6-O-[2-[2-[3-[5-(ethoxycarbonylamino)-1,3,3-trimethylcyclohexyl]propanoyloxy]ethoxy]ethyl] 1-O-ethyl hexanedioate.
| Compound Name | 6-O-[2-[2-[3-[5-(ethoxycarbonylamino)-1,3,3-trimethylcyclohexyl]propanoyloxy]ethoxy]ethyl] 1-O-ethyl hexanedioate |
|---|---|
| PubChem CID | 159405637 |
| Molecular Formula | C27H47NO9 |
| Molecular Weight | 529.67 g/mol |
| Exact Mass | 529.33 |
| IUPAC Name | 6-O-[2-[2-[3-[5-(ethoxycarbonylamino)-1,3,3-trimethylcyclohexyl]propanoyloxy]ethoxy]ethyl] 1-O-ethyl hexanedioate |
| SMILES | CCOC(=O)CCCCC(=O)OCCOCCOC(=O)CCC1(C)CC(NC(=O)OCC)CC(C)(C)C1 |
| InChI | InChI=1S/C27H47NO9/c1-6-34-22(29)10-8-9-11-23(30)36-16-14-33-15-17-37-24(31)12-13-27(5)19-21(18-26(3,4)20-27)28-25(32)35-7-2/h21H,6-20H2,1-5H3,(H,28,32) |
| InChIKey | WHMROPOJUPLNPZ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.67 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|