C25H41F3N2O8S — CID 159411802
tert-butyl 4-acetylpiperidine-1-carboxylate;tert-butyl 4-[1-(trifluoromethylsulfonyloxy)ethenyl]piperidine-1-carboxylate (PubChem CID 159411802) has the molecular formula C25H41F3N2O8S and a molecular weight of 586.67 g/mol. Its IUPAC name is tert-butyl 4-acetylpiperidine-1-carboxylate;tert-butyl 4-[1-(trifluoromethylsulfonyloxy)ethenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-acetylpiperidine-1-carboxylate;tert-butyl 4-[1-(trifluoromethylsulfonyloxy)ethenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 159411802 |
| Molecular Formula | C25H41F3N2O8S |
| Molecular Weight | 586.67 g/mol |
| Exact Mass | 586.25 |
| IUPAC Name | tert-butyl 4-acetylpiperidine-1-carboxylate;tert-butyl 4-[1-(trifluoromethylsulfonyloxy)ethenyl]piperidine-1-carboxylate |
| SMILES | C=C(OS(=O)(=O)C(F)(F)F)C1CCN(C(=O)OC(C)(C)C)CC1.CC(=O)C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C13H20F3NO5S.C12H21NO3/c1-9(22-23(19,20)13(14,15)16)10-5-7-17(8-6-10)11(18)21-12(2,3)4;1-9(14)10-5-7-13(8-6-10)11(15)16-12(2,3)4/h10H,1,5-8H2,2-4H3;10H,5-8H2,1-4H3 |
| InChIKey | LORAIIJIBQPHGT-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 119.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.67 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|