C29H52N2O10 — CID 159225828
tert-butyl 4-acetylpiperidine-1-carboxylate;tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate;methyl piperidine-4-carboxylate (PubChem CID 159225828) has the molecular formula C29H52N2O10 and a molecular weight of 588.74 g/mol. Its IUPAC name is tert-butyl 4-acetylpiperidine-1-carboxylate;tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate;methyl piperidine-4-carboxylate.
| Compound Name | tert-butyl 4-acetylpiperidine-1-carboxylate;tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate;methyl piperidine-4-carboxylate |
|---|---|
| PubChem CID | 159225828 |
| Molecular Formula | C29H52N2O10 |
| Molecular Weight | 588.74 g/mol |
| Exact Mass | 588.36 |
| IUPAC Name | tert-butyl 4-acetylpiperidine-1-carboxylate;tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate;methyl piperidine-4-carboxylate |
| SMILES | CC(=O)C1CCN(C(=O)OC(C)(C)C)CC1.CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.COC(=O)C1CCNCC1 |
| InChI | InChI=1S/C12H21NO3.C10H18O5.C7H13NO2/c1-9(14)10-5-7-13(8-6-10)11(15)16-12(2,3)4;1-9(2,3)14-7(11)13-8(12)15-10(4,5)6;1-10-7(9)6-2-4-8-5-3-6/h10H,5-8H2,1-4H3;1-6H3;6,8H,2-5H2,1H3 |
| InChIKey | KSGUIDVMLMHYCH-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 146.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.74 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|