C23H40O3Si — CID 15941190
ethyl 2-[3-[tert-butyl(dimethyl)silyl]oxy-3-(2,6,6-trimethylcyclohexen-1-yl)cyclobutylidene]acetate (PubChem CID 15941190) has the molecular formula C23H40O3Si and a molecular weight of 392.66 g/mol. Its IUPAC name is ethyl 2-[3-[tert-butyl(dimethyl)silyl]oxy-3-(2,6,6-trimethylcyclohexen-1-yl)cyclobutylidene]acetate.
| Compound Name | ethyl 2-[3-[tert-butyl(dimethyl)silyl]oxy-3-(2,6,6-trimethylcyclohexen-1-yl)cyclobutylidene]acetate |
|---|---|
| PubChem CID | 15941190 |
| Molecular Formula | C23H40O3Si |
| Molecular Weight | 392.66 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | ethyl 2-[3-[tert-butyl(dimethyl)silyl]oxy-3-(2,6,6-trimethylcyclohexen-1-yl)cyclobutylidene]acetate |
| SMILES | CCOC(=O)C=C1CC(O[Si](C)(C)C(C)(C)C)(C2=C(C)CCCC2(C)C)C1 |
| InChI | InChI=1S/C23H40O3Si/c1-10-25-19(24)14-18-15-23(16-18,26-27(8,9)21(3,4)5)20-17(2)12-11-13-22(20,6)7/h14H,10-13,15-16H2,1-9H3/b18-14- |
| InChIKey | MNIBKVYUQUPMOX-JXAWBTAJSA-N |
| XLogP | 6.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.66 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|