C25H42O3Si — CID 132599577
ethyl (3R)-3-[(E)-5-[(3S)-3-ethenyl-3-methyloxiran-2-yl]-3-methylpent-2-enyl]-3-methyl-2-(trimethylsilylmethyl)cyclohexene-1-carboxylate (PubChem CID 132599577) has the molecular formula C25H42O3Si and a molecular weight of 418.69 g/mol. Its IUPAC name is ethyl (3R)-3-[(E)-5-[(3S)-3-ethenyl-3-methyloxiran-2-yl]-3-methylpent-2-enyl]-3-methyl-2-(trimethylsilylmethyl)cyclohexene-1-carboxylate.
| Compound Name | ethyl (3R)-3-[(E)-5-[(3S)-3-ethenyl-3-methyloxiran-2-yl]-3-methylpent-2-enyl]-3-methyl-2-(trimethylsilylmethyl)cyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 132599577 |
| Molecular Formula | C25H42O3Si |
| Molecular Weight | 418.69 g/mol |
| Exact Mass | 418.29 |
| IUPAC Name | ethyl (3R)-3-[(E)-5-[(3S)-3-ethenyl-3-methyloxiran-2-yl]-3-methylpent-2-enyl]-3-methyl-2-(trimethylsilylmethyl)cyclohexene-1-carboxylate |
| SMILES | C=C[C@]1(C)OC1CC/C(C)=C/C[C@@]1(C)CCCC(C(=O)OCC)=C1C[Si](C)(C)C |
| InChI | InChI=1S/C25H42O3Si/c1-9-25(5)22(28-25)14-13-19(3)15-17-24(4)16-11-12-20(23(26)27-10-2)21(24)18-29(6,7)8/h9,15,22H,1,10-14,16-18H2,2-8H3/b19-15+/t22?,24-,25+/m1/s1 |
| InChIKey | WKEYGGLQZSZDPA-ZLIBUJKWSA-N |
| XLogP | 6.83 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.69 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|