C30H50O3Si — CID 138969011
ethyl (3R)-3-[(2E,6E)-9-[(3R)-3-ethenyl-3-methyloxiran-2-yl]-3,7-dimethylnona-2,6-dienyl]-3-methyl-2-(trimethylsilylmethyl)cyclohexene-1-carboxylate (PubChem CID 138969011) has the molecular formula C30H50O3Si and a molecular weight of 486.81 g/mol. Its IUPAC name is ethyl (3R)-3-[(2E,6E)-9-[(3R)-3-ethenyl-3-methyloxiran-2-yl]-3,7-dimethylnona-2,6-dienyl]-3-methyl-2-(trimethylsilylmethyl)cyclohexene-1-carboxylate.
| Compound Name | ethyl (3R)-3-[(2E,6E)-9-[(3R)-3-ethenyl-3-methyloxiran-2-yl]-3,7-dimethylnona-2,6-dienyl]-3-methyl-2-(trimethylsilylmethyl)cyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 138969011 |
| Molecular Formula | C30H50O3Si |
| Molecular Weight | 486.81 g/mol |
| Exact Mass | 486.35 |
| IUPAC Name | ethyl (3R)-3-[(2E,6E)-9-[(3R)-3-ethenyl-3-methyloxiran-2-yl]-3,7-dimethylnona-2,6-dienyl]-3-methyl-2-(trimethylsilylmethyl)cyclohexene-1-carboxylate |
| SMILES | C=C[C@@]1(C)OC1CC/C(C)=C/CC/C(C)=C/C[C@@]1(C)CCCC(C(=O)OCC)=C1C[Si](C)(C)C |
| InChI | InChI=1S/C30H50O3Si/c1-10-30(6)27(33-30)18-17-23(3)14-12-15-24(4)19-21-29(5)20-13-16-25(28(31)32-11-2)26(29)22-34(7,8)9/h10,14,19,27H,1,11-13,15-18,20-22H2,2-9H3/b23-14+,24-19+/t27?,29-,30-/m1/s1 |
| InChIKey | QHRCFWQPSKRTRI-LSJWNCNNSA-N |
| XLogP | 8.56 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.81 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|