C19H32O3Si — CID 11681579
ethyl 4-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbicyclo[4.2.0]octa-1,6-diene-7-carboxylate (PubChem CID 11681579) has the molecular formula C19H32O3Si and a molecular weight of 336.55 g/mol. Its IUPAC name is ethyl 4-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbicyclo[4.2.0]octa-1,6-diene-7-carboxylate.
| Compound Name | ethyl 4-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbicyclo[4.2.0]octa-1,6-diene-7-carboxylate |
|---|---|
| PubChem CID | 11681579 |
| Molecular Formula | C19H32O3Si |
| Molecular Weight | 336.55 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | ethyl 4-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbicyclo[4.2.0]octa-1,6-diene-7-carboxylate |
| SMILES | CCOC(=O)C1=C2CC(O[Si](C)(C)C(C)(C)C)C(C)(C)C=C2C1 |
| InChI | InChI=1S/C19H32O3Si/c1-9-21-17(20)15-10-13-12-19(5,6)16(11-14(13)15)22-23(7,8)18(2,3)4/h12,16H,9-11H2,1-8H3 |
| InChIKey | LLWSVKCHLJTSFW-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.55 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|