C22H20F3N3O11 — CID 159416984
2-ethoxy-6-nitrophenol;4-methoxy-2-nitrophenol;2-nitro-4-(trifluoromethyl)phenol (PubChem CID 159416984) has the molecular formula C22H20F3N3O11 and a molecular weight of 559.41 g/mol. Its IUPAC name is 2-ethoxy-6-nitrophenol;4-methoxy-2-nitrophenol;2-nitro-4-(trifluoromethyl)phenol.
| Compound Name | 2-ethoxy-6-nitrophenol;4-methoxy-2-nitrophenol;2-nitro-4-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 159416984 |
| Molecular Formula | C22H20F3N3O11 |
| Molecular Weight | 559.41 g/mol |
| Exact Mass | 559.10 |
| IUPAC Name | 2-ethoxy-6-nitrophenol;4-methoxy-2-nitrophenol;2-nitro-4-(trifluoromethyl)phenol |
| SMILES | CCOc1cccc([N+](=O)[O-])c1O.COc1ccc(O)c([N+](=O)[O-])c1.O=[N+]([O-])c1cc(C(F)(F)F)ccc1O |
| InChI | InChI=1S/C8H9NO4.C7H4F3NO3.C7H7NO4/c1-2-13-7-5-3-4-6(8(7)10)9(11)12;8-7(9,10)4-1-2-6(12)5(3-4)11(13)14;1-12-5-2-3-7(9)6(4-5)8(10)11/h3-5,10H,2H2,1H3;1-3,12H;2-4,9H,1H3 |
| InChIKey | LPGZEBJSJGCCPY-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 208.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.41 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|