C20H19F2N5O3S — CID 159420152
CID 159420152 (PubChem CID 159420152) has the molecular formula C20H19F2N5O3S and a molecular weight of 447.47 g/mol.
| Compound Name | CID 159420152 |
|---|---|
| PubChem CID | 159420152 |
| Molecular Formula | C20H19F2N5O3S |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | — |
| SMILES | Cc1cccc(Nc2cc(NCc3cc(F)cc(F)c3)c(C(N)=O)cn2)c1.N=S(=O)=O |
| InChI | InChI=1S/C20H18F2N4O.HNO2S/c1-12-3-2-4-16(5-12)26-19-9-18(17(11-25-19)20(23)27)24-10-13-6-14(21)8-15(22)7-13;1-4(2)3/h2-9,11H,10H2,1H3,(H2,23,27)(H2,24,25,26);1H |
| InChIKey | LPQXXXXSEBTGGP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 138.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |