C14H22 — CID 159433734
(7aR)-4,4,7,7-tetramethyl-2-methylidene-1,5,6,7a-tetrahydroindene (PubChem CID 159433734) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is (7aR)-4,4,7,7-tetramethyl-2-methylidene-1,5,6,7a-tetrahydroindene.
| Compound Name | (7aR)-4,4,7,7-tetramethyl-2-methylidene-1,5,6,7a-tetrahydroindene |
|---|---|
| PubChem CID | 159433734 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | (7aR)-4,4,7,7-tetramethyl-2-methylidene-1,5,6,7a-tetrahydroindene |
| SMILES | C=C1C=C2[C@H](C1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C14H22/c1-10-8-11-12(9-10)14(4,5)7-6-13(11,2)3/h8,12H,1,6-7,9H2,2-5H3/t12-/m0/s1 |
| InChIKey | LRHQIEWWPIUKLR-LBPRGKRZSA-N |
| XLogP | 4.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |