C14H20Cl2N2 — CID 15945810
4-chloro-N-cyclohexyl-N'-methylbenzenecarboximidamide;hydrochloride (PubChem CID 15945810) has the molecular formula C14H20Cl2N2 and a molecular weight of 287.23 g/mol. Its IUPAC name is 4-chloro-N-cyclohexyl-N'-methylbenzenecarboximidamide;hydrochloride.
| Compound Name | 4-chloro-N-cyclohexyl-N'-methylbenzenecarboximidamide;hydrochloride |
|---|---|
| PubChem CID | 15945810 |
| Molecular Formula | C14H20Cl2N2 |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 4-chloro-N-cyclohexyl-N'-methylbenzenecarboximidamide;hydrochloride |
| SMILES | C/N=C(/NC1CCCCC1)c1ccc(Cl)cc1.Cl |
| InChI | InChI=1S/C14H19ClN2.ClH/c1-16-14(11-7-9-12(15)10-8-11)17-13-5-3-2-4-6-13;/h7-10,13H,2-6H2,1H3,(H,16,17);1H |
| InChIKey | HRTFWAJZYIDAMR-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|