About azanium;ethane-1,1-diol;hydroxide
azanium;ethane-1,1-diol;hydroxide (PubChem CID 159460124) has the molecular formula C2H11NO3
and a molecular weight of 97.11 g/mol. Its IUPAC name is azanium;ethane-1,1-diol;hydroxide.
Molecular Properties
| Compound Name | azanium;ethane-1,1-diol;hydroxide |
| PubChem CID | 159460124 |
| Molecular Formula | C2H11NO3 |
| Molecular Weight | 97.11 g/mol |
| Exact Mass | 97.07 |
| IUPAC Name | azanium;ethane-1,1-diol;hydroxide |
| SMILES | CC(O)O.[NH4+].[OH-] |
| InChI | InChI=1S/C2H6O2.H3N.H2O/c1-2(3)4;;/h2-4H,1H3;1H3;1H2 |
| InChIKey | LUMIBOJVNTWGHI-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 106.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 97.11 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze azanium;ethane-1,1-diol;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium;ethane-1,1-diol;hydroxide?
The IUPAC name of azanium;ethane-1,1-diol;hydroxide (CID 159460124) is azanium;ethane-1,1-diol;hydroxide.
What is the SMILES notation for azanium;ethane-1,1-diol;hydroxide?
The canonical SMILES for azanium;ethane-1,1-diol;hydroxide is CC(O)O.[NH4+].[OH-].
What is the InChIKey of azanium;ethane-1,1-diol;hydroxide?
The InChIKey is LUMIBOJVNTWGHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6O2.H3N.H2O/c1-2(3)4;;/h2-4H,1H3;1H3;1H2.
What are the key properties of azanium;ethane-1,1-diol;hydroxide?
azanium;ethane-1,1-diol;hydroxide has a molecular weight of 97.11 g/mol, XLogP of -0.48, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azanium;ethane-1,1-diol;hydroxide is sourced from PubChem (CID 159460124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).