C19H36O3Si — CID 159465366
(4aR,6R,7S,8aR)-6-[(2R)-but-3-en-2-yl]-2,2-ditert-butyl-7-methyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasiline (PubChem CID 159465366) has the molecular formula C19H36O3Si and a molecular weight of 340.58 g/mol. Its IUPAC name is (4aR,6R,7S,8aR)-6-[(2R)-but-3-en-2-yl]-2,2-ditert-butyl-7-methyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasiline.
| Compound Name | (4aR,6R,7S,8aR)-6-[(2R)-but-3-en-2-yl]-2,2-ditert-butyl-7-methyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasiline |
|---|---|
| PubChem CID | 159465366 |
| Molecular Formula | C19H36O3Si |
| Molecular Weight | 340.58 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | (4aR,6R,7S,8aR)-6-[(2R)-but-3-en-2-yl]-2,2-ditert-butyl-7-methyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasiline |
| SMILES | C=C[C@@H](C)[C@@H]1O[C@@H]2CO[Si](C(C)(C)C)(C(C)(C)C)O[C@@H]2C[C@@H]1C |
| InChI | InChI=1S/C19H36O3Si/c1-10-13(2)17-14(3)11-15-16(21-17)12-20-23(22-15,18(4,5)6)19(7,8)9/h10,13-17H,1,11-12H2,2-9H3/t13-,14+,15-,16-,17+/m1/s1 |
| InChIKey | LVCNJKFQUSNBOG-JJTUDDRGSA-N |
| XLogP | 5.06 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.58 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|