C13H14N4S2 — CID 159467647
5-(aminomethyl)thiophene-2-carbonitrile;5-(methylaminomethyl)thiophene-2-carbonitrile (PubChem CID 159467647) has the molecular formula C13H14N4S2 and a molecular weight of 290.42 g/mol. Its IUPAC name is 5-(aminomethyl)thiophene-2-carbonitrile;5-(methylaminomethyl)thiophene-2-carbonitrile.
| Compound Name | 5-(aminomethyl)thiophene-2-carbonitrile;5-(methylaminomethyl)thiophene-2-carbonitrile |
|---|---|
| PubChem CID | 159467647 |
| Molecular Formula | C13H14N4S2 |
| Molecular Weight | 290.42 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 5-(aminomethyl)thiophene-2-carbonitrile;5-(methylaminomethyl)thiophene-2-carbonitrile |
| SMILES | CNCc1ccc(C#N)s1.N#Cc1ccc(CN)s1 |
| InChI | InChI=1S/C7H8N2S.C6H6N2S/c1-9-5-7-3-2-6(4-8)10-7;7-3-5-1-2-6(4-8)9-5/h2-3,9H,5H2,1H3;1-2H,3,7H2 |
| InChIKey | LVJVYRZGVASGOF-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 85.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.42 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |