C30H33N3O2 — CID 159493128
2-[4-[[3-methyl-5-[[4-(1,2,3,4-tetrahydropyridin-6-yl)phenoxy]methyl]phenyl]methoxy]phenyl]-1,4,5,6-tetrahydropyrimidine (PubChem CID 159493128) has the molecular formula C30H33N3O2 and a molecular weight of 467.61 g/mol. Its IUPAC name is 2-[4-[[3-methyl-5-[[4-(1,2,3,4-tetrahydropyridin-6-yl)phenoxy]methyl]phenyl]methoxy]phenyl]-1,4,5,6-tetrahydropyrimidine.
| Compound Name | 2-[4-[[3-methyl-5-[[4-(1,2,3,4-tetrahydropyridin-6-yl)phenoxy]methyl]phenyl]methoxy]phenyl]-1,4,5,6-tetrahydropyrimidine |
|---|---|
| PubChem CID | 159493128 |
| Molecular Formula | C30H33N3O2 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | 2-[4-[[3-methyl-5-[[4-(1,2,3,4-tetrahydropyridin-6-yl)phenoxy]methyl]phenyl]methoxy]phenyl]-1,4,5,6-tetrahydropyrimidine |
| SMILES | Cc1cc(COc2ccc(C3=CCCCN3)cc2)cc(COc2ccc(C3=NCCCN3)cc2)c1 |
| InChI | InChI=1S/C30H33N3O2/c1-22-17-23(20-34-27-10-6-25(7-11-27)29-5-2-3-14-31-29)19-24(18-22)21-35-28-12-8-26(9-13-28)30-32-15-4-16-33-30/h5-13,17-19,31H,2-4,14-16,20-21H2,1H3,(H,32,33) |
| InChIKey | LYLGJCPWUCKERX-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |