C18H26ClF2N2O3S- — CID 159495314
1-[1-[4-(difluoromethoxy)phenyl]sulfonylpiperidin-4-yl]-4-methylpiperidin-6-ide;hydrochloride (PubChem CID 159495314) has the molecular formula C18H26ClF2N2O3S- and a molecular weight of 423.93 g/mol. Its IUPAC name is 1-[1-[4-(difluoromethoxy)phenyl]sulfonylpiperidin-4-yl]-4-methylpiperidin-6-ide;hydrochloride.
| Compound Name | 1-[1-[4-(difluoromethoxy)phenyl]sulfonylpiperidin-4-yl]-4-methylpiperidin-6-ide;hydrochloride |
|---|---|
| PubChem CID | 159495314 |
| Molecular Formula | C18H26ClF2N2O3S- |
| Molecular Weight | 423.93 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 1-[1-[4-(difluoromethoxy)phenyl]sulfonylpiperidin-4-yl]-4-methylpiperidin-6-ide;hydrochloride |
| SMILES | CC1C[CH-]N(C2CCN(S(=O)(=O)c3ccc(OC(F)F)cc3)CC2)CC1.Cl |
| InChI | InChI=1S/C18H25F2N2O3S.ClH/c1-14-6-10-21(11-7-14)15-8-12-22(13-9-15)26(23,24)17-4-2-16(3-5-17)25-18(19)20;/h2-5,10,14-15,18H,6-9,11-13H2,1H3;1H/q-1; |
| InChIKey | BZNDYGQQFVRMNI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.93 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|