C22H44O8Si2 — CID 159502515
1-O-methyl 5-O-(2-trimethylsilylethyl) pentanedioate;2-methyl-2-(2-trimethylsilylethyl)pentanedioic acid (PubChem CID 159502515) has the molecular formula C22H44O8Si2 and a molecular weight of 492.76 g/mol. Its IUPAC name is 1-O-methyl 5-O-(2-trimethylsilylethyl) pentanedioate;2-methyl-2-(2-trimethylsilylethyl)pentanedioic acid.
| Compound Name | 1-O-methyl 5-O-(2-trimethylsilylethyl) pentanedioate;2-methyl-2-(2-trimethylsilylethyl)pentanedioic acid |
|---|---|
| PubChem CID | 159502515 |
| Molecular Formula | C22H44O8Si2 |
| Molecular Weight | 492.76 g/mol |
| Exact Mass | 492.26 |
| IUPAC Name | 1-O-methyl 5-O-(2-trimethylsilylethyl) pentanedioate;2-methyl-2-(2-trimethylsilylethyl)pentanedioic acid |
| SMILES | CC(CCC(=O)O)(CC[Si](C)(C)C)C(=O)O.COC(=O)CCCC(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/2C11H22O4Si/c1-11(10(14)15,6-5-9(12)13)7-8-16(2,3)4;1-14-10(12)6-5-7-11(13)15-8-9-16(2,3)4/h5-8H2,1-4H3,(H,12,13)(H,14,15);5-9H2,1-4H3 |
| InChIKey | LZOKKJWRUDAHIC-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.76 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|