C24H54O4Si4 — CID 18684364
2-ethyl-2,4,4-trimethyl-5-[2-methyl-4-tris(trimethylsilyl)silylbutan-2-yl]oxy-5-oxopentanoic acid (PubChem CID 18684364) has the molecular formula C24H54O4Si4 and a molecular weight of 519.04 g/mol. Its IUPAC name is 2-ethyl-2,4,4-trimethyl-5-[2-methyl-4-tris(trimethylsilyl)silylbutan-2-yl]oxy-5-oxopentanoic acid.
| Compound Name | 2-ethyl-2,4,4-trimethyl-5-[2-methyl-4-tris(trimethylsilyl)silylbutan-2-yl]oxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18684364 |
| Molecular Formula | C24H54O4Si4 |
| Molecular Weight | 519.04 g/mol |
| Exact Mass | 518.31 |
| IUPAC Name | 2-ethyl-2,4,4-trimethyl-5-[2-methyl-4-tris(trimethylsilyl)silylbutan-2-yl]oxy-5-oxopentanoic acid |
| SMILES | CCC(C)(CC(C)(C)C(=O)OC(C)(C)CC[Si]([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C)C(=O)O |
| InChI | InChI=1S/C24H54O4Si4/c1-16-24(6,20(25)26)19-22(2,3)21(27)28-23(4,5)17-18-32(29(7,8)9,30(10,11)12)31(13,14)15/h16-19H2,1-15H3,(H,25,26) |
| InChIKey | VQUVTFFFAOMBSF-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.04 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|