C17H34O7Si — CID 159823192
1-O-[3-[bis(hydroxymethyl)-methoxysilyl]propyl] 5-O-methyl 4-ethyl-2,2,4-trimethylpentanedioate (PubChem CID 159823192) has the molecular formula C17H34O7Si and a molecular weight of 378.54 g/mol. Its IUPAC name is 1-O-[3-[bis(hydroxymethyl)-methoxysilyl]propyl] 5-O-methyl 4-ethyl-2,2,4-trimethylpentanedioate.
| Compound Name | 1-O-[3-[bis(hydroxymethyl)-methoxysilyl]propyl] 5-O-methyl 4-ethyl-2,2,4-trimethylpentanedioate |
|---|---|
| PubChem CID | 159823192 |
| Molecular Formula | C17H34O7Si |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 1-O-[3-[bis(hydroxymethyl)-methoxysilyl]propyl] 5-O-methyl 4-ethyl-2,2,4-trimethylpentanedioate |
| SMILES | CCC(C)(CC(C)(C)C(=O)OCCC[Si](CO)(CO)OC)C(=O)OC |
| InChI | InChI=1S/C17H34O7Si/c1-7-17(4,15(21)22-5)11-16(2,3)14(20)24-9-8-10-25(12-18,13-19)23-6/h18-19H,7-13H2,1-6H3 |
| InChIKey | PXPKIZRDIWTDPP-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|