C27H52O10Si — CID 20678181
5-O-butyl 1-O-(3-hydroxypropyl) 3-O-(3-trimethoxysilylpropyl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate (PubChem CID 20678181) has the molecular formula C27H52O10Si and a molecular weight of 564.79 g/mol. Its IUPAC name is 5-O-butyl 1-O-(3-hydroxypropyl) 3-O-(3-trimethoxysilylpropyl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate.
| Compound Name | 5-O-butyl 1-O-(3-hydroxypropyl) 3-O-(3-trimethoxysilylpropyl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 20678181 |
| Molecular Formula | C27H52O10Si |
| Molecular Weight | 564.79 g/mol |
| Exact Mass | 564.33 |
| IUPAC Name | 5-O-butyl 1-O-(3-hydroxypropyl) 3-O-(3-trimethoxysilylpropyl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
| SMILES | CCCCOC(=O)C(C)(CC)CC(C)(CC(C)(C)C(=O)OCCCO)C(=O)OCCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C27H52O10Si/c1-10-12-16-36-23(30)26(5,11-2)21-27(6,20-25(3,4)22(29)35-17-13-15-28)24(31)37-18-14-19-38(32-7,33-8)34-9/h28H,10-21H2,1-9H3 |
| InChIKey | HGFUIRUMVFCXLF-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.79 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|