C24H46O10Si — CID 20678183
5-O-ethyl 1-O-(2-hydroxyethyl) 3-O-(3-trimethoxysilylpropyl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate (PubChem CID 20678183) has the molecular formula C24H46O10Si and a molecular weight of 522.71 g/mol. Its IUPAC name is 5-O-ethyl 1-O-(2-hydroxyethyl) 3-O-(3-trimethoxysilylpropyl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate.
| Compound Name | 5-O-ethyl 1-O-(2-hydroxyethyl) 3-O-(3-trimethoxysilylpropyl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 20678183 |
| Molecular Formula | C24H46O10Si |
| Molecular Weight | 522.71 g/mol |
| Exact Mass | 522.29 |
| IUPAC Name | 5-O-ethyl 1-O-(2-hydroxyethyl) 3-O-(3-trimethoxysilylpropyl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
| SMILES | CCOC(=O)C(C)(CC)CC(C)(CC(C)(C)C(=O)OCCO)C(=O)OCCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C24H46O10Si/c1-10-23(5,20(27)32-11-2)18-24(6,17-22(3,4)19(26)34-15-13-25)21(28)33-14-12-16-35(29-7,30-8)31-9/h25H,10-18H2,1-9H3 |
| InChIKey | YGIILGHEVURMHW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.71 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|