C22H42O10Si — CID 20678177
1-O-(2-hydroxyethyl) 5-O-methyl 3-O-(3-trimethoxysilylpropyl) 1,1,3-trimethylheptane-1,3,5-tricarboxylate (PubChem CID 20678177) has the molecular formula C22H42O10Si and a molecular weight of 494.65 g/mol. Its IUPAC name is 1-O-(2-hydroxyethyl) 5-O-methyl 3-O-(3-trimethoxysilylpropyl) 1,1,3-trimethylheptane-1,3,5-tricarboxylate.
| Compound Name | 1-O-(2-hydroxyethyl) 5-O-methyl 3-O-(3-trimethoxysilylpropyl) 1,1,3-trimethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 20678177 |
| Molecular Formula | C22H42O10Si |
| Molecular Weight | 494.65 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | 1-O-(2-hydroxyethyl) 5-O-methyl 3-O-(3-trimethoxysilylpropyl) 1,1,3-trimethylheptane-1,3,5-tricarboxylate |
| SMILES | CCC(CC(C)(CC(C)(C)C(=O)OCCO)C(=O)OCCC[Si](OC)(OC)OC)C(=O)OC |
| InChI | InChI=1S/C22H42O10Si/c1-9-17(18(24)27-5)15-22(4,16-21(2,3)19(25)32-13-11-23)20(26)31-12-10-14-33(28-6,29-7)30-8/h17,23H,9-16H2,1-8H3 |
| InChIKey | HAIAFSUEEAIKEP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.65 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|