C23H44O9Si — CID 20678180
3-O-[3-[dimethoxy(methyl)silyl]propyl] 1-O-(2-hydroxyethyl) 5-O-methyl 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate (PubChem CID 20678180) has the molecular formula C23H44O9Si and a molecular weight of 492.68 g/mol. Its IUPAC name is 3-O-[3-[dimethoxy(methyl)silyl]propyl] 1-O-(2-hydroxyethyl) 5-O-methyl 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate.
| Compound Name | 3-O-[3-[dimethoxy(methyl)silyl]propyl] 1-O-(2-hydroxyethyl) 5-O-methyl 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 20678180 |
| Molecular Formula | C23H44O9Si |
| Molecular Weight | 492.68 g/mol |
| Exact Mass | 492.28 |
| IUPAC Name | 3-O-[3-[dimethoxy(methyl)silyl]propyl] 1-O-(2-hydroxyethyl) 5-O-methyl 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
| SMILES | CCC(C)(CC(C)(CC(C)(C)C(=O)OCCO)C(=O)OCCC[Si](C)(OC)OC)C(=O)OC |
| InChI | InChI=1S/C23H44O9Si/c1-10-22(4,19(26)28-6)17-23(5,16-21(2,3)18(25)32-14-12-24)20(27)31-13-11-15-33(9,29-7)30-8/h24H,10-17H2,1-9H3 |
| InChIKey | CNXCGFWQYYEDRT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.68 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|