C23H44O10Si — CID 20678179
1-O-(3-hydroxypropyl) 5-O-methyl 3-O-(3-trimethoxysilylpropyl) 1,3,5-trimethylheptane-1,3,5-tricarboxylate (PubChem CID 20678179) has the molecular formula C23H44O10Si and a molecular weight of 508.68 g/mol. Its IUPAC name is 1-O-(3-hydroxypropyl) 5-O-methyl 3-O-(3-trimethoxysilylpropyl) 1,3,5-trimethylheptane-1,3,5-tricarboxylate.
| Compound Name | 1-O-(3-hydroxypropyl) 5-O-methyl 3-O-(3-trimethoxysilylpropyl) 1,3,5-trimethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 20678179 |
| Molecular Formula | C23H44O10Si |
| Molecular Weight | 508.68 g/mol |
| Exact Mass | 508.27 |
| IUPAC Name | 1-O-(3-hydroxypropyl) 5-O-methyl 3-O-(3-trimethoxysilylpropyl) 1,3,5-trimethylheptane-1,3,5-tricarboxylate |
| SMILES | CCC(C)(CC(C)(CC(C)C(=O)OCCCO)C(=O)OCCC[Si](OC)(OC)OC)C(=O)OC |
| InChI | InChI=1S/C23H44O10Si/c1-9-22(3,20(26)28-5)17-23(4,16-18(2)19(25)32-13-10-12-24)21(27)33-14-11-15-34(29-6,30-7)31-8/h18,24H,9-17H2,1-8H3 |
| InChIKey | FHZLFYVRZMQJAE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.68 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|