C23H52O2 — CID 159506983
methane;2,2,3,5,5-pentamethylhexan-3-ol;3,4,4,5,5-pentamethylhexan-3-ol (PubChem CID 159506983) has the molecular formula C23H52O2 and a molecular weight of 360.67 g/mol. Its IUPAC name is methane;2,2,3,5,5-pentamethylhexan-3-ol;3,4,4,5,5-pentamethylhexan-3-ol.
| Compound Name | methane;2,2,3,5,5-pentamethylhexan-3-ol;3,4,4,5,5-pentamethylhexan-3-ol |
|---|---|
| PubChem CID | 159506983 |
| Molecular Formula | C23H52O2 |
| Molecular Weight | 360.67 g/mol |
| Exact Mass | 360.40 |
| IUPAC Name | methane;2,2,3,5,5-pentamethylhexan-3-ol;3,4,4,5,5-pentamethylhexan-3-ol |
| SMILES | C.CC(C)(C)CC(C)(O)C(C)(C)C.CCC(C)(O)C(C)(C)C(C)(C)C |
| InChI | InChI=1S/2C11H24O.CH4/c1-9(2,3)8-11(7,12)10(4,5)6;1-8-11(7,12)10(5,6)9(2,3)4;/h2*12H,8H2,1-7H3;1H4 |
| InChIKey | MACRADAXRRUEMV-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.67 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |