About benzene-1,2-diol;methanol;2-(methylideneamino)guanidine
benzene-1,2-diol;methanol;2-(methylideneamino)guanidine (PubChem CID 159507696) has the molecular formula C9H16N4O3
and a molecular weight of 228.25 g/mol. Its IUPAC name is benzene-1,2-diol;methanol;2-(methylideneamino)guanidine.
Molecular Properties
| Compound Name | benzene-1,2-diol;methanol;2-(methylideneamino)guanidine |
| PubChem CID | 159507696 |
| Molecular Formula | C9H16N4O3 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | benzene-1,2-diol;methanol;2-(methylideneamino)guanidine |
| SMILES | C=NN=C(N)N.CO.Oc1ccccc1O |
| InChI | InChI=1S/C6H6O2.C2H6N4.CH4O/c7-5-3-1-2-4-6(5)8;1-5-6-2(3)4;1-2/h1-4,7-8H;1H2,(H4,3,4,6);2H,1H3 |
| InChIKey | MAEXSCKXDHVSHE-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 137.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,2-diol;methanol;2-(methylideneamino)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,2-diol;methanol;2-(methylideneamino)guanidine?
The IUPAC name of benzene-1,2-diol;methanol;2-(methylideneamino)guanidine (CID 159507696) is benzene-1,2-diol;methanol;2-(methylideneamino)guanidine.
What is the SMILES notation for benzene-1,2-diol;methanol;2-(methylideneamino)guanidine?
The canonical SMILES for benzene-1,2-diol;methanol;2-(methylideneamino)guanidine is C=NN=C(N)N.CO.Oc1ccccc1O.
What is the InChIKey of benzene-1,2-diol;methanol;2-(methylideneamino)guanidine?
The InChIKey is MAEXSCKXDHVSHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O2.C2H6N4.CH4O/c7-5-3-1-2-4-6(5)8;1-5-6-2(3)4;1-2/h1-4,7-8H;1H2,(H4,3,4,6);2H,1H3.
What are the key properties of benzene-1,2-diol;methanol;2-(methylideneamino)guanidine?
benzene-1,2-diol;methanol;2-(methylideneamino)guanidine has a molecular weight of 228.25 g/mol, XLogP of -0.42, 1 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,2-diol;methanol;2-(methylideneamino)guanidine is sourced from PubChem (CID 159507696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).