About tert-butyl 2-methylprop-2-eneperoxoate;2-phenylpropan-2-yl prop-2-eneperoxoate
tert-butyl 2-methylprop-2-eneperoxoate;2-phenylpropan-2-yl prop-2-eneperoxoate (PubChem CID 159540021) has the molecular formula C20H28O6
and a molecular weight of 364.44 g/mol. Its IUPAC name is tert-butyl 2-methylprop-2-eneperoxoate;2-phenylpropan-2-yl prop-2-eneperoxoate.
Molecular Properties
| Compound Name | tert-butyl 2-methylprop-2-eneperoxoate;2-phenylpropan-2-yl prop-2-eneperoxoate |
| PubChem CID | 159540021 |
| Molecular Formula | C20H28O6 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | tert-butyl 2-methylprop-2-eneperoxoate;2-phenylpropan-2-yl prop-2-eneperoxoate |
| SMILES | C=C(C)C(=O)OOC(C)(C)C.C=CC(=O)OOC(C)(C)c1ccccc1 |
| InChI | InChI=1S/C12H14O3.C8H14O3/c1-4-11(13)14-15-12(2,3)10-8-6-5-7-9-10;1-6(2)7(9)10-11-8(3,4)5/h4-9H,1H2,2-3H3;1H2,2-5H3 |
| InChIKey | MEBRWGODRRGUHJ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-methylprop-2-eneperoxoate;2-phenylpropan-2-yl prop-2-eneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-methylprop-2-eneperoxoate;2-phenylpropan-2-yl prop-2-eneperoxoate?
The IUPAC name of tert-butyl 2-methylprop-2-eneperoxoate;2-phenylpropan-2-yl prop-2-eneperoxoate (CID 159540021) is tert-butyl 2-methylprop-2-eneperoxoate;2-phenylpropan-2-yl prop-2-eneperoxoate.
What is the SMILES notation for tert-butyl 2-methylprop-2-eneperoxoate;2-phenylpropan-2-yl prop-2-eneperoxoate?
The canonical SMILES for tert-butyl 2-methylprop-2-eneperoxoate;2-phenylpropan-2-yl prop-2-eneperoxoate is C=C(C)C(=O)OOC(C)(C)C.C=CC(=O)OOC(C)(C)c1ccccc1.
What is the InChIKey of tert-butyl 2-methylprop-2-eneperoxoate;2-phenylpropan-2-yl prop-2-eneperoxoate?
The InChIKey is MEBRWGODRRGUHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O3.C8H14O3/c1-4-11(13)14-15-12(2,3)10-8-6-5-7-9-10;1-6(2)7(9)10-11-8(3,4)5/h4-9H,1H2,2-3H3;1H2,2-5H3.
What are the key properties of tert-butyl 2-methylprop-2-eneperoxoate;2-phenylpropan-2-yl prop-2-eneperoxoate?
tert-butyl 2-methylprop-2-eneperoxoate;2-phenylpropan-2-yl prop-2-eneperoxoate has a molecular weight of 364.44 g/mol, XLogP of 4.42, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-methylprop-2-eneperoxoate;2-phenylpropan-2-yl prop-2-eneperoxoate is sourced from PubChem (CID 159540021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).