C19H19F3N4O2 — CID 15954646
3-[2,6-dimethyl-4-[3-(6-methylpyridazin-3-yl)propoxy]phenyl]-5-(trifluoromethyl)-1,2,4-oxadiazole (PubChem CID 15954646) has the molecular formula C19H19F3N4O2 and a molecular weight of 392.38 g/mol. Its IUPAC name is 3-[2,6-dimethyl-4-[3-(6-methylpyridazin-3-yl)propoxy]phenyl]-5-(trifluoromethyl)-1,2,4-oxadiazole.
| Compound Name | 3-[2,6-dimethyl-4-[3-(6-methylpyridazin-3-yl)propoxy]phenyl]-5-(trifluoromethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 15954646 |
| Molecular Formula | C19H19F3N4O2 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 3-[2,6-dimethyl-4-[3-(6-methylpyridazin-3-yl)propoxy]phenyl]-5-(trifluoromethyl)-1,2,4-oxadiazole |
| SMILES | Cc1ccc(CCCOc2cc(C)c(-c3noc(C(F)(F)F)n3)c(C)c2)nn1 |
| InChI | InChI=1S/C19H19F3N4O2/c1-11-9-15(27-8-4-5-14-7-6-13(3)24-25-14)10-12(2)16(11)17-23-18(28-26-17)19(20,21)22/h6-7,9-10H,4-5,8H2,1-3H3 |
| InChIKey | CLFPXBCHWHOEDD-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 73.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|