C20H21F3N4O3 — CID 15954678
3-[4-[3-[6-(methoxymethyl)pyridazin-3-yl]propoxy]-2,6-dimethylphenyl]-5-(trifluoromethyl)-1,2,4-oxadiazole (PubChem CID 15954678) has the molecular formula C20H21F3N4O3 and a molecular weight of 422.41 g/mol. Its IUPAC name is 3-[4-[3-[6-(methoxymethyl)pyridazin-3-yl]propoxy]-2,6-dimethylphenyl]-5-(trifluoromethyl)-1,2,4-oxadiazole.
| Compound Name | 3-[4-[3-[6-(methoxymethyl)pyridazin-3-yl]propoxy]-2,6-dimethylphenyl]-5-(trifluoromethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 15954678 |
| Molecular Formula | C20H21F3N4O3 |
| Molecular Weight | 422.41 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 3-[4-[3-[6-(methoxymethyl)pyridazin-3-yl]propoxy]-2,6-dimethylphenyl]-5-(trifluoromethyl)-1,2,4-oxadiazole |
| SMILES | COCc1ccc(CCCOc2cc(C)c(-c3noc(C(F)(F)F)n3)c(C)c2)nn1 |
| InChI | InChI=1S/C20H21F3N4O3/c1-12-9-16(29-8-4-5-14-6-7-15(11-28-3)26-25-14)10-13(2)17(12)18-24-19(30-27-18)20(21,22)23/h6-7,9-10H,4-5,8,11H2,1-3H3 |
| InChIKey | DVDNLFJLXDHFSD-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 83.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.41 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|