C18H16F2N2O5 — CID 159569103
4-fluoro-7-nitro-2,3-dihydro-1H-indene;7-fluoro-4-nitro-2,3-dihydro-1H-inden-1-ol (PubChem CID 159569103) has the molecular formula C18H16F2N2O5 and a molecular weight of 378.33 g/mol. Its IUPAC name is 4-fluoro-7-nitro-2,3-dihydro-1H-indene;7-fluoro-4-nitro-2,3-dihydro-1H-inden-1-ol.
| Compound Name | 4-fluoro-7-nitro-2,3-dihydro-1H-indene;7-fluoro-4-nitro-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 159569103 |
| Molecular Formula | C18H16F2N2O5 |
| Molecular Weight | 378.33 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 4-fluoro-7-nitro-2,3-dihydro-1H-indene;7-fluoro-4-nitro-2,3-dihydro-1H-inden-1-ol |
| SMILES | O=[N+]([O-])c1ccc(F)c2c1CCC2.O=[N+]([O-])c1ccc(F)c2c1CCC2O |
| InChI | InChI=1S/C9H8FNO3.C9H8FNO2/c10-6-2-3-7(11(13)14)5-1-4-8(12)9(5)6;10-8-4-5-9(11(12)13)7-3-1-2-6(7)8/h2-3,8,12H,1,4H2;4-5H,1-3H2 |
| InChIKey | MHOWKULQXLBPRL-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 106.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.33 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|